C24H25NO3 — CID 26745
N-[3-hydroxy-1-(4-methoxyphenyl)-3,3-diphenylpropyl]acetamide (PubChem CID 26745) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[3-hydroxy-1-(4-methoxyphenyl)-3,3-diphenylpropyl]acetamide.
| Compound Name | N-[3-hydroxy-1-(4-methoxyphenyl)-3,3-diphenylpropyl]acetamide |
|---|---|
| PubChem CID | 26745 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[3-hydroxy-1-(4-methoxyphenyl)-3,3-diphenylpropyl]acetamide |
| SMILES | COc1ccc(C(CC(O)(c2ccccc2)c2ccccc2)NC(C)=O)cc1 |
| InChI | InChI=1S/C24H25NO3/c1-18(26)25-23(19-13-15-22(28-2)16-14-19)17-24(27,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,23,27H,17H2,1-2H3,(H,25,26) |
| InChIKey | VNQYRAUPXUHXOA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |