C21H20O3S — CID 11864321
2-[(S)-(4-methoxyphenyl)sulfinyl]-1,1-diphenylethanol (PubChem CID 11864321) has the molecular formula C21H20O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[(S)-(4-methoxyphenyl)sulfinyl]-1,1-diphenylethanol.
| Compound Name | 2-[(S)-(4-methoxyphenyl)sulfinyl]-1,1-diphenylethanol |
|---|---|
| PubChem CID | 11864321 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[(S)-(4-methoxyphenyl)sulfinyl]-1,1-diphenylethanol |
| SMILES | COc1ccc([S@@](=O)CC(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20O3S/c1-24-19-12-14-20(15-13-19)25(23)16-21(22,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,22H,16H2,1H3/t25-/m0/s1 |
| InChIKey | PLLNSUJVNFMBGI-VWLOTQADSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |