C23H24O4S — CID 71236406
1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinic acid (PubChem CID 71236406) has the molecular formula C23H24O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinic acid.
| Compound Name | 1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinic acid |
|---|---|
| PubChem CID | 71236406 |
| Molecular Formula | C23H24O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinic acid |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(C)S(=O)O)cc1 |
| InChI | InChI=1S/C23H24O4S/c1-17(28(24)25)23(18-7-5-4-6-8-18,19-9-13-21(26-2)14-10-19)20-11-15-22(27-3)16-12-20/h4-17H,1-3H3,(H,24,25) |
| InChIKey | XMTCICNTPXSQML-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|