C23H23O4S- — CID 71236405
1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinate (PubChem CID 71236405) has the molecular formula C23H23O4S- and a molecular weight of 395.50 g/mol. Its IUPAC name is 1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinate.
| Compound Name | 1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinate |
|---|---|
| PubChem CID | 71236405 |
| Molecular Formula | C23H23O4S- |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1,1-bis(4-methoxyphenyl)-1-phenylpropane-2-sulfinate |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(C)S(=O)[O-])cc1 |
| InChI | InChI=1S/C23H24O4S/c1-17(28(24)25)23(18-7-5-4-6-8-18,19-9-13-21(26-2)14-10-19)20-11-15-22(27-3)16-12-20/h4-17H,1-3H3,(H,24,25)/p-1 |
| InChIKey | XMTCICNTPXSQML-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|