C45H44O — CID 155021469
1-methoxy-4-[2-methyl-1-[4-(2-methyl-1,1,1-triphenylpropan-2-yl)phenyl]-1-phenylpropyl]benzene (PubChem CID 155021469) has the molecular formula C45H44O and a molecular weight of 600.85 g/mol. Its IUPAC name is 1-methoxy-4-[2-methyl-1-[4-(2-methyl-1,1,1-triphenylpropan-2-yl)phenyl]-1-phenylpropyl]benzene.
| Compound Name | 1-methoxy-4-[2-methyl-1-[4-(2-methyl-1,1,1-triphenylpropan-2-yl)phenyl]-1-phenylpropyl]benzene |
|---|---|
| PubChem CID | 155021469 |
| Molecular Formula | C45H44O |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | 1-methoxy-4-[2-methyl-1-[4-(2-methyl-1,1,1-triphenylpropan-2-yl)phenyl]-1-phenylpropyl]benzene |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(C(C)(C)C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C45H44O/c1-34(2)44(36-18-10-6-11-19-36,38-30-32-42(46-5)33-31-38)37-28-26-35(27-29-37)43(3,4)45(39-20-12-7-13-21-39,40-22-14-8-15-23-40)41-24-16-9-17-25-41/h6-34H,1-5H3 |
| InChIKey | SVCRZJGOJXVKNO-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|