C29H36O — CID 135291592
1-(2,2-dimethylpropyl)-4-[1-(4-methoxyphenyl)-2,2-dimethyl-1-phenylpropyl]benzene (PubChem CID 135291592) has the molecular formula C29H36O and a molecular weight of 400.61 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4-[1-(4-methoxyphenyl)-2,2-dimethyl-1-phenylpropyl]benzene.
| Compound Name | 1-(2,2-dimethylpropyl)-4-[1-(4-methoxyphenyl)-2,2-dimethyl-1-phenylpropyl]benzene |
|---|---|
| PubChem CID | 135291592 |
| Molecular Formula | C29H36O |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4-[1-(4-methoxyphenyl)-2,2-dimethyl-1-phenylpropyl]benzene |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(CC(C)(C)C)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H36O/c1-27(2,3)21-22-13-15-24(16-14-22)29(28(4,5)6,23-11-9-8-10-12-23)25-17-19-26(30-7)20-18-25/h8-20H,21H2,1-7H3 |
| InChIKey | FAACJULUUSUNPA-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|