C28H30O3 — CID 89454247
[4-[1-(4-methoxyphenyl)-2-phenylbut-3-en-2-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 89454247) has the molecular formula C28H30O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)-2-phenylbut-3-en-2-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[1-(4-methoxyphenyl)-2-phenylbut-3-en-2-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89454247 |
| Molecular Formula | C28H30O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)-2-phenylbut-3-en-2-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=CC(Cc1ccc(OC)cc1)(c1ccccc1)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H30O3/c1-6-28(22-10-8-7-9-11-22,20-21-12-16-24(30-5)17-13-21)23-14-18-25(19-15-23)31-26(29)27(2,3)4/h6-19H,1,20H2,2-5H3 |
| InChIKey | XPIXYZCGVWBGGG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|