C18H21N3O2 — CID 90028508
(2R)-N-(diaminomethylidene)-3-(4-methoxyphenyl)-2-methyl-2-phenylpropanamide (PubChem CID 90028508) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (2R)-N-(diaminomethylidene)-3-(4-methoxyphenyl)-2-methyl-2-phenylpropanamide.
| Compound Name | (2R)-N-(diaminomethylidene)-3-(4-methoxyphenyl)-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 90028508 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2R)-N-(diaminomethylidene)-3-(4-methoxyphenyl)-2-methyl-2-phenylpropanamide |
| SMILES | COc1ccc(C[C@@](C)(C(=O)N=C(N)N)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-18(16(22)21-17(19)20,14-6-4-3-5-7-14)12-13-8-10-15(23-2)11-9-13/h3-11H,12H2,1-2H3,(H4,19,20,21,22)/t18-/m1/s1 |
| InChIKey | XGKMBJVVBPADOJ-GOSISDBHSA-N |
| XLogP | 2.00 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|