C37H38O7 — CID 145094435
[4-[(4-methoxyphenyl)-bis(4-propanoyloxyphenyl)methyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 145094435) has the molecular formula C37H38O7 and a molecular weight of 594.70 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)-bis(4-propanoyloxyphenyl)methyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(4-methoxyphenyl)-bis(4-propanoyloxyphenyl)methyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 145094435 |
| Molecular Formula | C37H38O7 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | [4-[(4-methoxyphenyl)-bis(4-propanoyloxyphenyl)methyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCC(=O)Oc1ccc(C(c2ccc(OC)cc2)(c2ccc(OC(=O)CC)cc2)c2ccc(OC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H38O7/c1-7-33(38)42-30-19-11-26(12-20-30)37(25-9-17-29(41-6)18-10-25,27-13-21-31(22-14-27)43-34(39)8-2)28-15-23-32(24-16-28)44-35(40)36(3,4)5/h9-24H,7-8H2,1-6H3 |
| InChIKey | RHKCHTLHRTXLBH-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|