C14H14F6O3 — CID 126558090
[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2,2-dimethylpropanoate (PubChem CID 126558090) has the molecular formula C14H14F6O3 and a molecular weight of 344.25 g/mol. Its IUPAC name is [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126558090 |
| Molecular Formula | C14H14F6O3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F6O3/c1-11(2,3)10(21)23-9-6-4-8(5-7-9)12(22,13(15,16)17)14(18,19)20/h4-7,22H,1-3H3 |
| InChIKey | LKVLWHUJQUHMRO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|