C15H18O5 — CID 20644319
[4-(3-methoxy-3-oxopropanoyl)phenyl] 2,2-dimethylpropanoate (PubChem CID 20644319) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is [4-(3-methoxy-3-oxopropanoyl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(3-methoxy-3-oxopropanoyl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 20644319 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [4-(3-methoxy-3-oxopropanoyl)phenyl] 2,2-dimethylpropanoate |
| SMILES | COC(=O)CC(=O)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H18O5/c1-15(2,3)14(18)20-11-7-5-10(6-8-11)12(16)9-13(17)19-4/h5-8H,9H2,1-4H3 |
| InChIKey | UCYMYVDSQLFCPJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|