C21H20O2S — CID 2767182
2-(4-methoxyphenyl)sulfanyl-1,1-diphenylethanol (PubChem CID 2767182) has the molecular formula C21H20O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfanyl-1,1-diphenylethanol.
| Compound Name | 2-(4-methoxyphenyl)sulfanyl-1,1-diphenylethanol |
|---|---|
| PubChem CID | 2767182 |
| Molecular Formula | C21H20O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfanyl-1,1-diphenylethanol |
| SMILES | COc1ccc(SCC(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20O2S/c1-23-19-12-14-20(15-13-19)24-16-21(22,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,22H,16H2,1H3 |
| InChIKey | QPZHHNSKPQZKLP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |