C25H26O4S2 — CID 14593774
ethyl 3,3-bis[(4-methoxyphenyl)sulfanyl]-3-phenylpropanoate (PubChem CID 14593774) has the molecular formula C25H26O4S2 and a molecular weight of 454.61 g/mol. Its IUPAC name is ethyl 3,3-bis[(4-methoxyphenyl)sulfanyl]-3-phenylpropanoate.
| Compound Name | ethyl 3,3-bis[(4-methoxyphenyl)sulfanyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 14593774 |
| Molecular Formula | C25H26O4S2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | ethyl 3,3-bis[(4-methoxyphenyl)sulfanyl]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(Sc1ccc(OC)cc1)(Sc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H26O4S2/c1-4-29-24(26)18-25(19-8-6-5-7-9-19,30-22-14-10-20(27-2)11-15-22)31-23-16-12-21(28-3)13-17-23/h5-17H,4,18H2,1-3H3 |
| InChIKey | GCLZXIDMVURLSE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|