C16H18O6S — CID 59966678
[2-hydroxy-2,2-bis(4-methoxyphenyl)ethyl] hydrogen sulfite (PubChem CID 59966678) has the molecular formula C16H18O6S and a molecular weight of 338.38 g/mol. Its IUPAC name is [2-hydroxy-2,2-bis(4-methoxyphenyl)ethyl] hydrogen sulfite.
| Compound Name | [2-hydroxy-2,2-bis(4-methoxyphenyl)ethyl] hydrogen sulfite |
|---|---|
| PubChem CID | 59966678 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [2-hydroxy-2,2-bis(4-methoxyphenyl)ethyl] hydrogen sulfite |
| SMILES | COc1ccc(C(O)(COS(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H18O6S/c1-20-14-7-3-12(4-8-14)16(17,11-22-23(18)19)13-5-9-15(21-2)10-6-13/h3-10,17H,11H2,1-2H3,(H,18,19) |
| InChIKey | ORELAGZBRLVGBN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|