C12H16O5 — CID 121000481
ethyl (2R)-2,3-dihydroxy-2-(4-methoxyphenyl)propanoate (PubChem CID 121000481) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl (2R)-2,3-dihydroxy-2-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl (2R)-2,3-dihydroxy-2-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 121000481 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl (2R)-2,3-dihydroxy-2-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@](O)(CO)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H16O5/c1-3-17-11(14)12(15,8-13)9-4-6-10(16-2)7-5-9/h4-7,13,15H,3,8H2,1-2H3/t12-/m0/s1 |
| InChIKey | QWODWZJHVWRIKZ-LBPRGKRZSA-N |
| XLogP | 0.44 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |