C24H25O5P — CID 132569331
ethyl 3-diphenylphosphoryl-2-hydroxy-2-(4-methoxyphenyl)propanoate (PubChem CID 132569331) has the molecular formula C24H25O5P and a molecular weight of 424.43 g/mol. Its IUPAC name is ethyl 3-diphenylphosphoryl-2-hydroxy-2-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-diphenylphosphoryl-2-hydroxy-2-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 132569331 |
| Molecular Formula | C24H25O5P |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | ethyl 3-diphenylphosphoryl-2-hydroxy-2-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(O)(CP(=O)(c1ccccc1)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H25O5P/c1-3-29-23(25)24(26,19-14-16-20(28-2)17-15-19)18-30(27,21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-17,26H,3,18H2,1-2H3 |
| InChIKey | NFIRTQUIFXZWFM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|