C35H42O9 — CID 66672416
diethyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-2-(2,2-dimethylpropanoyloxy)propanedioate (PubChem CID 66672416) has the molecular formula C35H42O9 and a molecular weight of 606.71 g/mol. Its IUPAC name is diethyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-2-(2,2-dimethylpropanoyloxy)propanedioate.
| Compound Name | diethyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-2-(2,2-dimethylpropanoyloxy)propanedioate |
|---|---|
| PubChem CID | 66672416 |
| Molecular Formula | C35H42O9 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | diethyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-2-(2,2-dimethylpropanoyloxy)propanedioate |
| SMILES | CCOC(=O)C(CCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)(OC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C35H42O9/c1-8-41-31(37)34(32(38)42-9-2,44-30(36)33(3,4)5)23-24-43-35(25-13-11-10-12-14-25,26-15-19-28(39-6)20-16-26)27-17-21-29(40-7)22-18-27/h10-22H,8-9,23-24H2,1-7H3 |
| InChIKey | SJLFXWKKJQTGEX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|