C28H30O5 — CID 23075047
ethyl 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate (PubChem CID 23075047) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is ethyl 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 23075047 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | ethyl 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H30O5/c1-4-32-27(29)26-18-20(26)19-33-28(21-8-6-5-7-9-21,22-10-14-24(30-2)15-11-22)23-12-16-25(31-3)17-13-23/h5-17,20,26H,4,18-19H2,1-3H3 |
| InChIKey | XPHTUAICLDEYTM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|