C41H48O5 — CID 23075000
(2,6-ditert-butyl-4-methylphenyl) 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate (PubChem CID 23075000) has the molecular formula C41H48O5 and a molecular weight of 620.83 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 23075000 |
| Molecular Formula | C41H48O5 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]cyclopropane-1-carboxylate |
| SMILES | COc1ccc(C(OCC2CC2C(=O)Oc2c(C(C)(C)C)cc(C)cc2C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H48O5/c1-27-23-35(39(2,3)4)37(36(24-27)40(5,6)7)46-38(42)34-25-28(34)26-45-41(29-13-11-10-12-14-29,30-15-19-32(43-8)20-16-30)31-17-21-33(44-9)22-18-31/h10-24,28,34H,25-26H2,1-9H3 |
| InChIKey | FBENVGOPEVDFPD-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|