C29H30O7 — CID 23244298
[(2S,3R,4S)-2-acetyloxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate (PubChem CID 23244298) has the molecular formula C29H30O7 and a molecular weight of 490.55 g/mol. Its IUPAC name is [(2S,3R,4S)-2-acetyloxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate.
| Compound Name | [(2S,3R,4S)-2-acetyloxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 23244298 |
| Molecular Formula | C29H30O7 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(2S,3R,4S)-2-acetyloxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate |
| SMILES | COc1ccc(C(OC[C@H]2CO[C@@H](OC(C)=O)[C@@H]2OC(C)=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30O7/c1-20(30)35-27-22(18-33-28(27)36-21(2)31)19-34-29(23-10-6-4-7-11-23,24-12-8-5-9-13-24)25-14-16-26(32-3)17-15-25/h4-17,22,27-28H,18-19H2,1-3H3/t22-,27-,28+/m1/s1 |
| InChIKey | JZZYUUPPHPDVGH-OFEZKSIWSA-N |
| XLogP | 4.47 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|