C32H34O10 — CID 59114129
4-[[3-acetyloxy-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methoxy]-4-oxobutanoic acid (PubChem CID 59114129) has the molecular formula C32H34O10 and a molecular weight of 578.61 g/mol. Its IUPAC name is 4-[[3-acetyloxy-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[3-acetyloxy-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59114129 |
| Molecular Formula | C32H34O10 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 4-[[3-acetyloxy-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methoxy]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(OC2COC(COC(=O)CCC(=O)O)C2OC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H34O10/c1-21(33)41-31-27(19-40-30(36)18-17-29(34)35)39-20-28(31)42-32(22-7-5-4-6-8-22,23-9-13-25(37-2)14-10-23)24-11-15-26(38-3)16-12-24/h4-16,27-28,31H,17-20H2,1-3H3,(H,34,35) |
| InChIKey | PRWSQZWLUBCEPT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|