C34H38N2O8 — CID 102185045
[3-[bis(4-methoxyphenyl)-phenylmethoxy]-6-carbamoyl-5-(propylcarbamoyl)-7-oxabicyclo[2.2.1]heptan-2-yl] acetate (PubChem CID 102185045) has the molecular formula C34H38N2O8 and a molecular weight of 602.68 g/mol. Its IUPAC name is [3-[bis(4-methoxyphenyl)-phenylmethoxy]-6-carbamoyl-5-(propylcarbamoyl)-7-oxabicyclo[2.2.1]heptan-2-yl] acetate.
| Compound Name | [3-[bis(4-methoxyphenyl)-phenylmethoxy]-6-carbamoyl-5-(propylcarbamoyl)-7-oxabicyclo[2.2.1]heptan-2-yl] acetate |
|---|---|
| PubChem CID | 102185045 |
| Molecular Formula | C34H38N2O8 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | [3-[bis(4-methoxyphenyl)-phenylmethoxy]-6-carbamoyl-5-(propylcarbamoyl)-7-oxabicyclo[2.2.1]heptan-2-yl] acetate |
| SMILES | CCCNC(=O)C1C2OC(C(OC(C)=O)C2OC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C1C(N)=O |
| InChI | InChI=1S/C34H38N2O8/c1-5-19-36-33(39)27-26(32(35)38)28-30(42-20(2)37)31(29(27)43-28)44-34(21-9-7-6-8-10-21,22-11-15-24(40-3)16-12-22)23-13-17-25(41-4)18-14-23/h6-18,26-31H,5,19H2,1-4H3,(H2,35,38)(H,36,39) |
| InChIKey | QAAMLXRZPODXBA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|