C30H29NO7 — CID 90975128
6-[bis(4-methoxyphenyl)-phenylmethoxy]-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 90975128) has the molecular formula C30H29NO7 and a molecular weight of 515.56 g/mol. Its IUPAC name is 6-[bis(4-methoxyphenyl)-phenylmethoxy]-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | 6-[bis(4-methoxyphenyl)-phenylmethoxy]-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 90975128 |
| Molecular Formula | C30H29NO7 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 6-[bis(4-methoxyphenyl)-phenylmethoxy]-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | COc1ccc(C(OC2C3OC(c4c3c(O)n(C)c4O)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H29NO7/c1-31-28(33)22-23(29(31)34)26-27(24(32)25(22)37-26)38-30(17-7-5-4-6-8-17,18-9-13-20(35-2)14-10-18)19-11-15-21(36-3)16-12-19/h4-16,24-27,32-34H,1-3H3 |
| InChIKey | MSKPGDAXZVXGLS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|