C31H30F6N2O8 — CID 171125828
N-[(2R)-2-[(2R,3S,4S,5S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3,5-dihydroxyoxolan-2-yl]-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 171125828) has the molecular formula C31H30F6N2O8 and a molecular weight of 672.58 g/mol. Its IUPAC name is N-[(2R)-2-[(2R,3S,4S,5S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3,5-dihydroxyoxolan-2-yl]-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R)-2-[(2R,3S,4S,5S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3,5-dihydroxyoxolan-2-yl]-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 171125828 |
| Molecular Formula | C31H30F6N2O8 |
| Molecular Weight | 672.58 g/mol |
| Exact Mass | 672.19 |
| IUPAC Name | N-[(2R)-2-[(2R,3S,4S,5S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3,5-dihydroxyoxolan-2-yl]-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(C(O[C@H]2[C@@H](O)[C@@H]([C@@H](CNC(=O)C(F)(F)F)NC(=O)C(F)(F)F)O[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H30F6N2O8/c1-44-20-12-8-18(9-13-20)29(17-6-4-3-5-7-17,19-10-14-21(45-2)15-11-19)47-25-23(40)24(46-26(25)41)22(39-28(43)31(35,36)37)16-38-27(42)30(32,33)34/h3-15,22-26,40-41H,16H2,1-2H3,(H,38,42)(H,39,43)/t22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | MOYFHIHDGJLCIC-NRWDCXGPSA-N |
| XLogP | 3.18 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|