C37H39NO10 — CID 168830110
6-[(5S,6R)-5-acetyloxy-6-[bis(4-methoxyphenyl)-phenylmethoxy]-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]hexanoic acid (PubChem CID 168830110) has the molecular formula C37H39NO10 and a molecular weight of 657.72 g/mol. Its IUPAC name is 6-[(5S,6R)-5-acetyloxy-6-[bis(4-methoxyphenyl)-phenylmethoxy]-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(5S,6R)-5-acetyloxy-6-[bis(4-methoxyphenyl)-phenylmethoxy]-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 168830110 |
| Molecular Formula | C37H39NO10 |
| Molecular Weight | 657.72 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | 6-[(5S,6R)-5-acetyloxy-6-[bis(4-methoxyphenyl)-phenylmethoxy]-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]hexanoic acid |
| SMILES | COc1ccc(C(O[C@@H]2C3OC(C4C(=O)N(CCCCCC(=O)O)C(=O)C43)[C@@H]2OC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H39NO10/c1-22(39)46-33-31-29-30(36(43)38(35(29)42)21-9-5-8-12-28(40)41)32(47-31)34(33)48-37(23-10-6-4-7-11-23,24-13-17-26(44-2)18-14-24)25-15-19-27(45-3)20-16-25/h4,6-7,10-11,13-20,29-34H,5,8-9,12,21H2,1-3H3,(H,40,41)/t29?,30?,31?,32?,33-,34+/m0/s1 |
| InChIKey | VDJWXPKTXWYCGV-CSYVNIGBSA-N |
| XLogP | 4.34 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|