C36H44N2O10 — CID 155433671
2-[(2R,3R,4R,5R,6R)-4-acetyloxy-5-(2-amino-2-oxoethyl)-6-(3-aminopropoxy)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxan-3-yl]acetic acid (PubChem CID 155433671) has the molecular formula C36H44N2O10 and a molecular weight of 664.75 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R,6R)-4-acetyloxy-5-(2-amino-2-oxoethyl)-6-(3-aminopropoxy)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4R,5R,6R)-4-acetyloxy-5-(2-amino-2-oxoethyl)-6-(3-aminopropoxy)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 155433671 |
| Molecular Formula | C36H44N2O10 |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | 2-[(2R,3R,4R,5R,6R)-4-acetyloxy-5-(2-amino-2-oxoethyl)-6-(3-aminopropoxy)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxan-3-yl]acetic acid |
| SMILES | COc1ccc(C(OC[C@@H]2O[C@@H](OCCCN)[C@H](CC(N)=O)[C@H](OC(C)=O)[C@H]2CC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H44N2O10/c1-23(39)47-34-29(21-33(41)42)31(48-35(45-19-7-18-37)30(34)20-32(38)40)22-46-36(24-8-5-4-6-9-24,25-10-14-27(43-2)15-11-25)26-12-16-28(44-3)17-13-26/h4-6,8-17,29-31,34-35H,7,18-22,37H2,1-3H3,(H2,38,40)(H,41,42)/t29-,30+,31-,34+,35+/m0/s1 |
| InChIKey | MHEPQODXLSRSFH-YSKKBSKVSA-N |
| XLogP | 3.62 |
| TPSA | 178.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|