C19H23NO8 — CID 134558439
[(3R)-3,4-diacetyloxy-5-benzamidooxan-2-yl]methyl acetate (PubChem CID 134558439) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is [(3R)-3,4-diacetyloxy-5-benzamidooxan-2-yl]methyl acetate.
| Compound Name | [(3R)-3,4-diacetyloxy-5-benzamidooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134558439 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(3R)-3,4-diacetyloxy-5-benzamidooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OCC(NC(=O)c2ccccc2)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H23NO8/c1-11(21)25-10-16-18(28-13(3)23)17(27-12(2)22)15(9-26-16)20-19(24)14-7-5-4-6-8-14/h4-8,15-18H,9-10H2,1-3H3,(H,20,24)/t15?,16?,17?,18-/m0/s1 |
| InChIKey | VHKWPGDLPJNEQG-HLYMMOCJSA-N |
| XLogP | 0.61 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|