C16H26N2O7S — CID 71134959
[(2R,3S,4R,5R)-3,4-diacetyloxy-5-[(N-ethyl-C-methylsulfanylcarbonimidoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 71134959) has the molecular formula C16H26N2O7S and a molecular weight of 390.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-5-[(N-ethyl-C-methylsulfanylcarbonimidoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-[(N-ethyl-C-methylsulfanylcarbonimidoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71134959 |
| Molecular Formula | C16H26N2O7S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-[(N-ethyl-C-methylsulfanylcarbonimidoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC/N=C(/N[C@@H]1CO[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)SC |
| InChI | InChI=1S/C16H26N2O7S/c1-6-17-16(26-5)18-12-7-23-13(8-22-9(2)19)15(25-11(4)21)14(12)24-10(3)20/h12-15H,6-8H2,1-5H3,(H,17,18)/t12-,13-,14-,15-/m1/s1 |
| InChIKey | ZUIIIXGSPAJHAK-KBUPBQIOSA-N |
| XLogP | 0.51 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|