C23H27NO12 — CID 5082995
[3,4,6-triacetyloxy-5-[(4-acetyloxybenzoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 5082995) has the molecular formula C23H27NO12 and a molecular weight of 509.46 g/mol. Its IUPAC name is [3,4,6-triacetyloxy-5-[(4-acetyloxybenzoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,6-triacetyloxy-5-[(4-acetyloxybenzoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 5082995 |
| Molecular Formula | C23H27NO12 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | [3,4,6-triacetyloxy-5-[(4-acetyloxybenzoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(NC(=O)c2ccc(OC(C)=O)cc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H27NO12/c1-11(25)31-10-18-20(33-13(3)27)21(34-14(4)28)19(23(36-18)35-15(5)29)24-22(30)16-6-8-17(9-7-16)32-12(2)26/h6-9,18-21,23H,10H2,1-5H3,(H,24,30) |
| InChIKey | XXNZMFRRIXFOKZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|