C38H35N3O8 — CID 163296258
[(2R,3R,4S)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-3-yl] benzoate (PubChem CID 163296258) has the molecular formula C38H35N3O8 and a molecular weight of 661.71 g/mol. Its IUPAC name is [(2R,3R,4S)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 163296258 |
| Molecular Formula | C38H35N3O8 |
| Molecular Weight | 661.71 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | [(2R,3R,4S)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-3-yl] benzoate |
| SMILES | COc1ccc(C(O[C@H]2CO[C@@H](n3ccc(NC(C)=O)nc3=O)[C@@H]2OC(=O)c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H35N3O8/c1-25(42)39-33-22-23-41(37(44)40-33)35-34(48-36(43)26-10-6-4-7-11-26)32(24-47-35)49-38(27-12-8-5-9-13-27,28-14-18-30(45-2)19-15-28)29-16-20-31(46-3)21-17-29/h4-23,32,34-35H,24H2,1-3H3,(H,39,40,42,44)/t32-,34+,35+/m0/s1 |
| InChIKey | KXYRHHFBRVUNEU-RRKBCBNCSA-N |
| XLogP | 5.35 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|