C38H36N2O9 — CID 11399649
[(2R,3R,4R,5R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate (PubChem CID 11399649) has the molecular formula C38H36N2O9 and a molecular weight of 664.71 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11399649 |
| Molecular Formula | C38H36N2O9 |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate |
| SMILES | COc1ccc(C(O[C@@H]2CO[C@@H](n3cc(C)c(=O)[nH]c3=O)[C@H](OC(=O)c3ccccc3)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H36N2O9/c1-24-22-40(37(44)39-34(24)42)35-33(48-36(43)25-10-6-4-7-11-25)32(41)31(23-47-35)49-38(26-12-8-5-9-13-26,27-14-18-29(45-2)19-15-27)28-16-20-30(46-3)21-17-28/h4-22,31-33,35,41H,23H2,1-3H3,(H,39,42,44)/t31-,32-,33-,35-/m1/s1 |
| InChIKey | DTBPTYIMDQNRSP-DYICDNQCSA-N |
| XLogP | 4.35 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|