C32H29F3N2O9 — CID 171500256
2,2,2-trifluoroethyl 1-[(2R,3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxyoxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate (PubChem CID 171500256) has the molecular formula C32H29F3N2O9 and a molecular weight of 642.58 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 1-[(2R,3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxyoxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 1-[(2R,3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxyoxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 171500256 |
| Molecular Formula | C32H29F3N2O9 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | 2,2,2-trifluoroethyl 1-[(2R,3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxyoxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate |
| SMILES | COc1ccc(C(OC2CO[C@@H](n3cc(C(=O)OCC(F)(F)F)c(=O)[nH]c3=O)[C@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H29F3N2O9/c1-42-22-12-8-20(9-13-22)32(19-6-4-3-5-7-19,21-10-14-23(43-2)15-11-21)46-25-17-44-28(26(25)38)37-16-24(27(39)36-30(37)41)29(40)45-18-31(33,34)35/h3-16,25-26,28,38H,17-18H2,1-2H3,(H,36,39,41)/t25?,26-,28+/m0/s1 |
| InChIKey | QATRFMMJVKMFFJ-ZLEDJERYSA-N |
| XLogP | 3.54 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|