C30H27BrF2N2O6 — CID 169068197
1-[(2R,3S,4R,5R)-5-(bromomethyl)-3-fluoro-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 169068197) has the molecular formula C30H27BrF2N2O6 and a molecular weight of 629.45 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-5-(bromomethyl)-3-fluoro-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-5-(bromomethyl)-3-fluoro-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169068197 |
| Molecular Formula | C30H27BrF2N2O6 |
| Molecular Weight | 629.45 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-5-(bromomethyl)-3-fluoro-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | COc1ccc(C(O[C@H]2[C@H](F)[C@H](n3cc(F)c(=O)[nH]c3=O)O[C@@]2(CO)CBr)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27BrF2N2O6/c1-39-22-14-12-21(13-15-22)30(19-8-4-2-5-9-19,20-10-6-3-7-11-20)40-25-24(33)27(41-29(25,17-31)18-36)35-16-23(32)26(37)34-28(35)38/h2-16,24-25,27,36H,17-18H2,1H3,(H,34,37,38)/t24-,25-,27+,29+/m0/s1 |
| InChIKey | MIUWNDXIXFUOBW-OFPSWZBWSA-N |
| XLogP | 4.05 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|