C42H43FN2O13 — CID 20632020
[(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-3,4,5-trimethoxybenzoate (PubChem CID 20632020) has the molecular formula C42H43FN2O13 and a molecular weight of 802.81 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-3,4,5-trimethoxybenzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 20632020 |
| Molecular Formula | C42H43FN2O13 |
| Molecular Weight | 802.81 g/mol |
| Exact Mass | 802.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-3,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(C(OCCc2c(C(=O)OC[C@H]3O[C@@H](n4cc(F)c(=O)[nH]c4=O)[C@H](O)[C@@H]3O)cc(OC)c(OC)c2OC)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H43FN2O13/c1-51-27-15-11-25(12-16-27)42(24-9-7-6-8-10-24,26-13-17-28(52-2)18-14-26)57-20-19-29-30(21-32(53-3)37(55-5)36(29)54-4)40(49)56-23-33-34(46)35(47)39(58-33)45-22-31(43)38(48)44-41(45)50/h6-18,21-22,33-35,39,46-47H,19-20,23H2,1-5H3,(H,44,48,50)/t33-,34-,35-,39-/m1/s1 |
| InChIKey | FFHBALYKQFBSIN-QZHHCZDESA-N |
| XLogP | 3.75 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.81 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|