C38H35N3O8 — CID 91668489
N-[1-[(1R,3R,4S,7R)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 91668489) has the molecular formula C38H35N3O8 and a molecular weight of 661.71 g/mol. Its IUPAC name is N-[1-[(1R,3R,4S,7R)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(1R,3R,4S,7R)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91668489 |
| Molecular Formula | C38H35N3O8 |
| Molecular Weight | 661.71 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | N-[1-[(1R,3R,4S,7R)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@@]23CO[C@H]([C@H](n4ccc(NC(=O)c5ccccc5)nc4=O)O2)[C@H]3O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H35N3O8/c1-45-29-17-13-27(14-18-29)38(26-11-7-4-8-12-26,28-15-19-30(46-2)20-16-28)48-24-37-23-47-32(33(37)42)35(49-37)41-22-21-31(40-36(41)44)39-34(43)25-9-5-3-6-10-25/h3-22,32-33,35,42H,23-24H2,1-2H3,(H,39,40,43,44)/t32-,33+,35+,37+/m0/s1 |
| InChIKey | CJLDDJQAEGSEFN-CWEDSRHFSA-N |
| XLogP | 4.55 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.71 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|