C39H37N3O8 — CID 69183439
N-[1-[(1R,5R,7R,8S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-8-hydroxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 69183439) has the molecular formula C39H37N3O8 and a molecular weight of 675.74 g/mol. Its IUPAC name is N-[1-[(1R,5R,7R,8S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-8-hydroxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(1R,5R,7R,8S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-8-hydroxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 69183439 |
| Molecular Formula | C39H37N3O8 |
| Molecular Weight | 675.74 g/mol |
| Exact Mass | 675.26 |
| IUPAC Name | N-[1-[(1R,5R,7R,8S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-8-hydroxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@@]23CCO[C@@H]([C@H](n4ccc(NC(=O)c5ccccc5)nc4=O)O2)[C@@H]3O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H37N3O8/c1-46-30-17-13-28(14-18-30)39(27-11-7-4-8-12-27,29-15-19-31(47-2)20-16-29)49-25-38-22-24-48-33(34(38)43)36(50-38)42-23-21-32(41-37(42)45)40-35(44)26-9-5-3-6-10-26/h3-21,23,33-34,36,43H,22,24-25H2,1-2H3,(H,40,41,44,45)/t33-,34+,36-,38-/m1/s1 |
| InChIKey | BZVJCTAQBOWJLY-HXLDXHICSA-N |
| XLogP | 4.94 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|