C42H47N3O7Si — CID 11422742
N-[1-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 11422742) has the molecular formula C42H47N3O7Si and a molecular weight of 733.94 g/mol. Its IUPAC name is N-[1-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 11422742 |
| Molecular Formula | C42H47N3O7Si |
| Molecular Weight | 733.94 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | N-[1-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)c4ccccc4)nc3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H47N3O7Si/c1-41(2,3)53(5,6)52-37-36(46)34(51-39(37)45-27-26-35(44-40(45)48)43-38(47)29-16-10-7-11-17-29)28-50-42(30-18-12-8-13-19-30,31-20-14-9-15-21-31)32-22-24-33(49-4)25-23-32/h7-27,34,36-37,39,46H,28H2,1-6H3,(H,43,44,47,48)/t34-,36-,37-,39-/m1/s1 |
| InChIKey | AFDGXIKNRXDUSK-CBOKRJPRSA-N |
| XLogP | 7.16 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.94 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|