C32H39NO5 — CID 165010410
N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide (PubChem CID 165010410) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 165010410 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide |
| SMILES | COc1ccc(C(OCC2CC(O)C(NC(C)=O)C(C)C2C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H39NO5/c1-21-22(2)31(33-23(3)34)30(35)19-24(21)20-38-32(25-9-7-6-8-10-25,26-11-15-28(36-4)16-12-26)27-13-17-29(37-5)18-14-27/h6-18,21-22,24,30-31,35H,19-20H2,1-5H3,(H,33,34) |
| InChIKey | AYHXJTBYXKJYMX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|