C45H45NO11 — CID 164788381
[5-acetamido-4-benzoyloxy-6-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate (PubChem CID 164788381) has the molecular formula C45H45NO11 and a molecular weight of 775.85 g/mol. Its IUPAC name is [5-acetamido-4-benzoyloxy-6-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate.
| Compound Name | [5-acetamido-4-benzoyloxy-6-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 164788381 |
| Molecular Formula | C45H45NO11 |
| Molecular Weight | 775.85 g/mol |
| Exact Mass | 775.30 |
| IUPAC Name | [5-acetamido-4-benzoyloxy-6-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate |
| SMILES | COc1ccc(C(OCCOC2OC(CO)C(OC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2NC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H45NO11/c1-30(48)46-39-41(57-43(50)32-15-9-5-10-16-32)40(56-42(49)31-13-7-4-8-14-31)38(29-47)55-44(39)53-27-28-54-45(33-17-11-6-12-18-33,34-19-23-36(51-2)24-20-34)35-21-25-37(52-3)26-22-35/h4-26,38-41,44,47H,27-29H2,1-3H3,(H,46,48) |
| InChIKey | JQKVAKPNHXQEKT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.85 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|