C48H60N3O10P — CID 164947277
[3-acetamido-2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-methyloxan-4-yl] benzoate (PubChem CID 164947277) has the molecular formula C48H60N3O10P and a molecular weight of 869.99 g/mol. Its IUPAC name is [3-acetamido-2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-methyloxan-4-yl] benzoate.
| Compound Name | [3-acetamido-2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-methyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 164947277 |
| Molecular Formula | C48H60N3O10P |
| Molecular Weight | 869.99 g/mol |
| Exact Mass | 869.40 |
| IUPAC Name | [3-acetamido-2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-methyloxan-4-yl] benzoate |
| SMILES | COc1ccc(C(OCCOC2OC(COP(OCCC#N)N(C(C)C)C(C)C)C(C)C(OC(=O)c3ccccc3)C2NC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H60N3O10P/c1-33(2)51(34(3)4)62(58-29-15-28-49)59-32-43-35(5)45(61-46(53)37-16-11-9-12-17-37)44(50-36(6)52)47(60-43)56-30-31-57-48(38-18-13-10-14-19-38,39-20-24-41(54-7)25-21-39)40-22-26-42(55-8)27-23-40/h9-14,16-27,33-35,43-45,47H,15,29-32H2,1-8H3,(H,50,52) |
| InChIKey | UHBBITFRYWLVEL-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.99 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|