C47H59N2O9P — CID 165073699
[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-6-ethyl-4-methyloxan-3-yl] benzoate (PubChem CID 165073699) has the molecular formula C47H59N2O9P and a molecular weight of 826.97 g/mol. Its IUPAC name is [2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-6-ethyl-4-methyloxan-3-yl] benzoate.
| Compound Name | [2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-6-ethyl-4-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 165073699 |
| Molecular Formula | C47H59N2O9P |
| Molecular Weight | 826.97 g/mol |
| Exact Mass | 826.40 |
| IUPAC Name | [2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-6-ethyl-4-methyloxan-3-yl] benzoate |
| SMILES | [C-]#[N+]CCOP(OC1C(CC)OC(OCCOC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(OC(=O)c2ccccc2)C1C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C47H59N2O9P/c1-10-42-43(58-59(55-30-29-48-7)49(33(2)3)34(4)5)35(6)44(57-45(50)36-17-13-11-14-18-36)46(56-42)53-31-32-54-47(37-19-15-12-16-20-37,38-21-25-40(51-8)26-22-38)39-23-27-41(52-9)28-24-39/h11-28,33-35,42-44,46H,10,29-32H2,1-6,8-9H3 |
| InChIKey | MFKVVZOGSQZNDZ-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 98.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.97 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|