C45H64N3O8P — CID 165002158
N-[6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxypentoxy]-4,5-dimethyloxan-3-yl]acetamide (PubChem CID 165002158) has the molecular formula C45H64N3O8P and a molecular weight of 805.99 g/mol. Its IUPAC name is N-[6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxypentoxy]-4,5-dimethyloxan-3-yl]acetamide.
| Compound Name | N-[6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxypentoxy]-4,5-dimethyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 165002158 |
| Molecular Formula | C45H64N3O8P |
| Molecular Weight | 805.99 g/mol |
| Exact Mass | 805.44 |
| IUPAC Name | N-[6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[5-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxypentoxy]-4,5-dimethyloxan-3-yl]acetamide |
| SMILES | [C-]#[N+]CCOP(OCCCCCOC1OC(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(C)C(C)C1NC(C)=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C45H64N3O8P/c1-32(2)48(33(3)4)57(55-30-27-46-8)54-29-16-12-15-28-52-44-43(47-36(7)49)35(6)34(5)42(56-44)31-53-45(37-17-13-11-14-18-37,38-19-23-40(50-9)24-20-38)39-21-25-41(51-10)26-22-39/h11,13-14,17-26,32-35,42-44H,12,15-16,27-31H2,1-7,9-10H3,(H,47,49) |
| InChIKey | ZOWUYKKEEMOYDF-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.99 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|