C48H66N2O11 — CID 161208274
[5-acetamido-6-[11-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl-(2-hydroxyethyl)amino]-6,11-dioxoundecoxy]-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 161208274) has the molecular formula C48H66N2O11 and a molecular weight of 847.06 g/mol. Its IUPAC name is [5-acetamido-6-[11-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl-(2-hydroxyethyl)amino]-6,11-dioxoundecoxy]-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-6-[11-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl-(2-hydroxyethyl)amino]-6,11-dioxoundecoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 161208274 |
| Molecular Formula | C48H66N2O11 |
| Molecular Weight | 847.06 g/mol |
| Exact Mass | 846.47 |
| IUPAC Name | [5-acetamido-6-[11-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl-(2-hydroxyethyl)amino]-6,11-dioxoundecoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | COc1ccc(C(OCCN(CCO)C(=O)CCCCC(=O)CCCCCOC2OC(COC(C)=O)C(C)C(C)C2NC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H66N2O11/c1-34-35(2)46(49-36(3)52)47(61-44(34)33-59-37(4)53)58-31-14-8-11-17-41(54)18-12-13-19-45(55)50(28-30-51)29-32-60-48(38-15-9-7-10-16-38,39-20-24-42(56-5)25-21-39)40-22-26-43(57-6)27-23-40/h7,9-10,15-16,20-27,34-35,44,46-47,51H,8,11-14,17-19,28-33H2,1-6H3,(H,49,52) |
| InChIKey | ZMRGDNOHPQFYNR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.06 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|