C47H42N6O8 — CID 15546265
[(2R,3R,4S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate (PubChem CID 15546265) has the molecular formula C47H42N6O8 and a molecular weight of 818.89 g/mol. Its IUPAC name is [(2R,3R,4S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 15546265 |
| Molecular Formula | C47H42N6O8 |
| Molecular Weight | 818.89 g/mol |
| Exact Mass | 818.31 |
| IUPAC Name | [(2R,3R,4S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] acetate |
| SMILES | COc1ccc(C(OC[C@H]2CO[C@@H](n3cnc4c(OC(=O)N(c5ccccc5)c5ccccc5)nc(NC(C)=O)nc43)[C@@H]2OC(C)=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H42N6O8/c1-31(54)49-45-50-42-40(43(51-45)61-46(56)53(37-20-12-6-13-21-37)38-22-14-7-15-23-38)48-30-52(42)44-41(60-32(2)55)33(28-58-44)29-59-47(34-16-8-4-9-17-34,35-18-10-5-11-19-35)36-24-26-39(57-3)27-25-36/h4-27,30,33,41,44H,28-29H2,1-3H3,(H,49,50,51,54)/t33-,41-,44-/m1/s1 |
| InChIKey | PIKMUNKJVTTYIC-TZUBOTLNSA-N |
| XLogP | 8.22 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.89 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|