C48H44N6O9 — CID 11445830
[(2R,3R,5S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-[bis(4-methoxyphenyl)-phenylmethoxy]oxan-3-yl] acetate (PubChem CID 11445830) has the molecular formula C48H44N6O9 and a molecular weight of 848.91 g/mol. Its IUPAC name is [(2R,3R,5S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-[bis(4-methoxyphenyl)-phenylmethoxy]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,5S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-[bis(4-methoxyphenyl)-phenylmethoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11445830 |
| Molecular Formula | C48H44N6O9 |
| Molecular Weight | 848.91 g/mol |
| Exact Mass | 848.32 |
| IUPAC Name | [(2R,3R,5S)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-[bis(4-methoxyphenyl)-phenylmethoxy]oxan-3-yl] acetate |
| SMILES | COc1ccc(C(O[C@@H]2CO[C@@H](n3cnc4c(OC(=O)N(c5ccccc5)c5ccccc5)nc(NC(C)=O)nc43)[C@H](OC(C)=O)C2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H44N6O9/c1-31(55)50-46-51-43-42(44(52-46)62-47(57)54(36-16-10-6-11-17-36)37-18-12-7-13-19-37)49-30-53(43)45-41(61-32(2)56)28-40(29-60-45)63-48(33-14-8-5-9-15-33,34-20-24-38(58-3)25-21-34)35-22-26-39(59-4)27-23-35/h5-27,30,40-41,45H,28-29H2,1-4H3,(H,50,51,52,55)/t40-,41+,45+/m0/s1 |
| InChIKey | UVRKYIYBBUQOBO-NBPAGFATSA-N |
| XLogP | 8.37 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.91 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|