C42H40N6O6 — CID 53342274
[2-acetamido-9-[(1R,3R,4R,5R,7S)-5-methyl-7-phenylmethoxy-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]purin-6-yl] N,N-diphenylcarbamate (PubChem CID 53342274) has the molecular formula C42H40N6O6 and a molecular weight of 724.82 g/mol. Its IUPAC name is [2-acetamido-9-[(1R,3R,4R,5R,7S)-5-methyl-7-phenylmethoxy-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]purin-6-yl] N,N-diphenylcarbamate.
| Compound Name | [2-acetamido-9-[(1R,3R,4R,5R,7S)-5-methyl-7-phenylmethoxy-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]purin-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 53342274 |
| Molecular Formula | C42H40N6O6 |
| Molecular Weight | 724.82 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | [2-acetamido-9-[(1R,3R,4R,5R,7S)-5-methyl-7-phenylmethoxy-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]purin-6-yl] N,N-diphenylcarbamate |
| SMILES | CC(=O)Nc1nc(OC(=O)N(c2ccccc2)c2ccccc2)c2ncn([C@@H]3O[C@@]4(COCc5ccccc5)C[C@@H](C)[C@@H]3[C@@H]4OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C42H40N6O6/c1-28-23-42(26-51-24-30-15-7-3-8-16-30)36(52-25-31-17-9-4-10-18-31)34(28)39(54-42)47-27-43-35-37(47)45-40(44-29(2)49)46-38(35)53-41(50)48(32-19-11-5-12-20-32)33-21-13-6-14-22-33/h3-22,27-28,34,36,39H,23-26H2,1-2H3,(H,44,45,46,49)/t28-,34-,36+,39-,42-/m1/s1 |
| InChIKey | REGKXUNKWOJIBL-LXZGKEIQSA-N |
| XLogP | 7.85 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.82 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |