C39H54N6O5Si2 — CID 177384790
[9-[(1S,2R,4R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-2-(2-methylpropylamino)purin-6-yl] N,N-diphenylcarbamate (PubChem CID 177384790) has the molecular formula C39H54N6O5Si2 and a molecular weight of 743.07 g/mol. Its IUPAC name is [9-[(1S,2R,4R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-2-(2-methylpropylamino)purin-6-yl] N,N-diphenylcarbamate.
| Compound Name | [9-[(1S,2R,4R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-2-(2-methylpropylamino)purin-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 177384790 |
| Molecular Formula | C39H54N6O5Si2 |
| Molecular Weight | 743.07 g/mol |
| Exact Mass | 742.37 |
| IUPAC Name | [9-[(1S,2R,4R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-2-(2-methylpropylamino)purin-6-yl] N,N-diphenylcarbamate |
| SMILES | CC(C)CNc1nc(OC(=O)N(c2ccccc2)c2ccccc2)c2ncn([C@H]3C[C@@]4(O[Si](C)(C)C)C[C@H]5C[C@]5(O[Si](C)(C)C(C)(C)C)[C@H]4O3)c2n1 |
| InChI | InChI=1S/C39H54N6O5Si2/c1-26(2)24-40-35-42-32-31(33(43-35)48-36(46)45(28-17-13-11-14-18-28)29-19-15-12-16-20-29)41-25-44(32)30-23-38(49-51(6,7)8)21-27-22-39(27,34(38)47-30)50-52(9,10)37(3,4)5/h11-20,25-27,30,34H,21-24H2,1-10H3,(H,40,42,43)/t27-,30+,34-,38-,39+/m0/s1 |
| InChIKey | VJWFZIASKFLJPO-YKWVXTFHSA-N |
| XLogP | 9.29 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.07 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|