C36H37N6O10P — CID 59795740
[(2R,3S,5R)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-(diethoxyphosphorylmethoxy)oxolan-3-yl] benzoate (PubChem CID 59795740) has the molecular formula C36H37N6O10P and a molecular weight of 744.70 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-(diethoxyphosphorylmethoxy)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5R)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-(diethoxyphosphorylmethoxy)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 59795740 |
| Molecular Formula | C36H37N6O10P |
| Molecular Weight | 744.70 g/mol |
| Exact Mass | 744.23 |
| IUPAC Name | [(2R,3S,5R)-2-[2-acetamido-6-(diphenylcarbamoyloxy)purin-9-yl]-5-(diethoxyphosphorylmethoxy)oxolan-3-yl] benzoate |
| SMILES | CCOP(=O)(CO[C@@H]1C[C@H](OC(=O)c2ccccc2)[C@H](n2cnc3c(OC(=O)N(c4ccccc4)c4ccccc4)nc(NC(C)=O)nc32)O1)OCC |
| InChI | InChI=1S/C36H37N6O10P/c1-4-48-53(46,49-5-2)23-47-29-21-28(50-34(44)25-15-9-6-10-16-25)33(51-29)41-22-37-30-31(41)39-35(38-24(3)43)40-32(30)52-36(45)42(26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,22,28-29,33H,4-5,21,23H2,1-3H3,(H,38,39,40,43)/t28-,29-,33+/m0/s1 |
| InChIKey | IPDBDLKTIYZBLL-XNMCCTNNSA-N |
| XLogP | 6.83 |
| TPSA | 182.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.70 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|