C17H23O8P — CID 58521276
[(3S,5R)-2-acetyloxy-5-[[ethoxy(methyl)phosphoryl]methoxy]oxolan-3-yl] benzoate (PubChem CID 58521276) has the molecular formula C17H23O8P and a molecular weight of 386.34 g/mol. Its IUPAC name is [(3S,5R)-2-acetyloxy-5-[[ethoxy(methyl)phosphoryl]methoxy]oxolan-3-yl] benzoate.
| Compound Name | [(3S,5R)-2-acetyloxy-5-[[ethoxy(methyl)phosphoryl]methoxy]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 58521276 |
| Molecular Formula | C17H23O8P |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(3S,5R)-2-acetyloxy-5-[[ethoxy(methyl)phosphoryl]methoxy]oxolan-3-yl] benzoate |
| SMILES | CCOP(C)(=O)CO[C@@H]1C[C@H](OC(=O)c2ccccc2)C(OC(C)=O)O1 |
| InChI | InChI=1S/C17H23O8P/c1-4-22-26(3,20)11-21-15-10-14(17(25-15)23-12(2)18)24-16(19)13-8-6-5-7-9-13/h5-9,14-15,17H,4,10-11H2,1-3H3/t14-,15-,17?,26?/m0/s1 |
| InChIKey | NZWHIEUWNLNPPD-NNCBHZIWSA-N |
| XLogP | 2.77 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|