C23H28N5O6P — CID 59289254
[(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-2-[6-(methylamino)purin-9-yl]oxolan-3-yl] benzoate (PubChem CID 59289254) has the molecular formula C23H28N5O6P and a molecular weight of 501.48 g/mol. Its IUPAC name is [(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-2-[6-(methylamino)purin-9-yl]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-2-[6-(methylamino)purin-9-yl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 59289254 |
| Molecular Formula | C23H28N5O6P |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [(2R,3R,5S)-5-[(E)-2-diethoxyphosphorylethenyl]-2-[6-(methylamino)purin-9-yl]oxolan-3-yl] benzoate |
| SMILES | CCOP(=O)(/C=C/[C@@H]1C[C@@H](OC(=O)c2ccccc2)[C@H](n2cnc3c(NC)ncnc32)O1)OCC |
| InChI | InChI=1S/C23H28N5O6P/c1-4-31-35(30,32-5-2)12-11-17-13-18(34-23(29)16-9-7-6-8-10-16)22(33-17)28-15-27-19-20(24-3)25-14-26-21(19)28/h6-12,14-15,17-18,22H,4-5,13H2,1-3H3,(H,24,25,26)/b12-11+/t17-,18-,22-/m1/s1 |
| InChIKey | OEFSQJRLJLAOFQ-FNZOGOMMSA-N |
| XLogP | 4.16 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|